|
CAS#: 16424-66-1 Product: 2,2,3,3,5,5,6,6-Octamethyl-4-Heptanone No suppilers available for the product. |
| Name | 2,2,3,3,5,5,6,6-Octamethyl-4-Heptanone |
|---|---|
| Synonyms | 2,2,3,3,5,5,6,6-Octamethyl-4-heptanone # |
| Molecular Structure | ![]() |
| Molecular Formula | C15H30O |
| Molecular Weight | 226.40 |
| CAS Registry Number | 16424-66-1 |
| SMILES | O=C(C(C(C)(C)C)(C)C)C(C)(C(C)(C)C)C |
| InChI | 1S/C15H30O/c1-12(2,3)14(7,8)11(16)15(9,10)13(4,5)6/h1-10H3 |
| InChIKey | BDJFEVCOWJKPFZ-UHFFFAOYSA-N |
| Density | 0.828g/cm3 (Cal.) |
|---|---|
| Boiling point | 236.24°C at 760 mmHg (Cal.) |
| Flash point | 55.272°C (Cal.) |
| Refractive index | 1.436 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,3,3,5,5,6,6-Octamethyl-4-Heptanone |