| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
![]() |
+41 (24) 466-2929 | |||
![]() |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| International Laboratory Limited | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (650) 278-9963 | |||
![]() |
admin@intlab.org | |||
| Chemical manufacturer since 2002 | ||||
| Manchester Organics Ltd. | UK | Inquire | ||
|---|---|---|---|---|
![]() |
+44 (1928) 710-200 | |||
![]() |
info@manchesterorganics.com | |||
| Chemical manufacturer | ||||
| P and M Invest Ltd. | Russian Federation | Inquire | ||
|---|---|---|---|---|
![]() |
+7 (495) 135-6494 | |||
![]() |
sales@fluorine.ru | |||
| Chemical manufacturer | ||||
| TimTec | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (302) 292-8500 | |||
![]() |
info@timtec.com | |||
| Chemical manufacturer | ||||
| Name | 2,2-Dichloro-1,1,1,3,3,3-Hexafluoropropane |
|---|---|
| Synonyms | 2,2-Dichloro-1,1,1,3,3,3-Hexafluoro-Propane; 2,2-Dichlorohexafluoropropane |
| Molecular Structure | ![]() |
| Molecular Formula | C3Cl2F6 |
| Molecular Weight | 220.93 |
| CAS Registry Number | 1652-80-8 |
| EINECS | 216-717-9 |
| SMILES | ClC(Cl)(C(F)(F)F)C(F)(F)F |
| InChI | 1S/C3Cl2F6/c4-1(5,2(6,7)8)3(9,10)11 |
| InChIKey | YVOASHYXFVSAQN-UHFFFAOYSA-N |
| Density | 1.653g/cm3 (Cal.) |
|---|---|
| Melting point | 1-3°C (Expl.) |
| Boiling point | 35°C (Expl.) |
| 37.216°C at 760 mmHg (Cal.) | |
| Flash point | -21.162°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dichloro-1,1,1,3,3,3-Hexafluoropropane |