|
CAS#: 16597-58-3 Product: (2Z)-2-Amino-3-[(1Z)-3-Oxo-1-Propen-1-Yl]-2-Butenedioic Acid No suppilers available for the product. |
| Name | (2Z)-2-Amino-3-[(1Z)-3-Oxo-1-Propen-1-Yl]-2-Butenedioic Acid |
|---|---|
| Synonyms | (2Z)-2-amino-3-[(1Z)-3-oxoprop-1-en-1-yl]but-2-enedioic acid; 2-Amino-3-(3-oxoprop-1-en-1-yl)but-2-enedioate; 2-Amino-3-(3-oxoprop-1-enyl)-but-2-enedioate |
| Molecular Structure | ![]() |
| Molecular Formula | C7H7NO5 |
| Molecular Weight | 185.13 |
| CAS Registry Number | 16597-58-3 |
| SMILES | O=C(O)C(\C=C/C=O)=C(/N)C(=O)O |
| InChI | 1S/C7H7NO5/c8-5(7(12)13)4(6(10)11)2-1-3-9/h1-3H,8H2,(H,10,11)(H,12,13)/b2-1-,5-4- |
| InChIKey | KACPVQQHDVBVFC-OIFXTYEKSA-N |
| Density | 1.528g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.768°C at 760 mmHg (Cal.) |
| Flash point | 188.92°C (Cal.) |
| Refractive index | 1.594 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (2Z)-2-Amino-3-[(1Z)-3-Oxo-1-Propen-1-Yl]-2-Butenedioic Acid |