|
CAS#: 16602-96-3 Product: (1-Methyl-3-phenylpropyl)-Hydrazine sulfate (1:1) No suppilers available for the product. |
| Name | (1-Methyl-3-phenylpropyl)-Hydrazine sulfate (1:1) |
|---|---|
| Synonyms | (1-Methyl-3-Phenyl-Propyl)Hydrazine; Sulfuric Acid; (1-Methyl-3-Phenylpropyl)Hydrazine; Sulfuric Acid; Hydrazine, (1-Methyl-3-Phenylpropyl)-, Sulfate (1:1) |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18N2O4S |
| Molecular Weight | 262.32 |
| CAS Registry Number | 16602-96-3 |
| SMILES | O=[S](O)(O)=O.C1=CC=CC=C1CCC(NN)C |
| InChI | 1S/C10H16N2.H2O4S/c1-9(12-11)7-8-10-5-3-2-4-6-10;1-5(2,3)4/h2-6,9,12H,7-8,11H2,1H3;(H2,1,2,3,4) |
| InChIKey | OHYNYZWRJAZQBK-UHFFFAOYSA-N |
| Boiling point | 300.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 158°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (1-Methyl-3-phenylpropyl)-Hydrazine sulfate (1:1) |