|
CAS#: 16662-86-5 Product: S-{[(4-Chlorophenyl)Sulfinyl]Methyl} O,O-Diethyl Phosphorothioate No suppilers available for the product. |
| Name | S-{[(4-Chlorophenyl)Sulfinyl]Methyl} O,O-Diethyl Phosphorothioate |
|---|---|
| Synonyms | Carbophenothion O-analog sulfoxide; CARBOPHENOXON SULFOXIDE |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16ClO4PS2 |
| Molecular Weight | 342.80 |
| CAS Registry Number | 16662-86-5 |
| SMILES | O=S(c1ccc(Cl)cc1)CSP(=O)(OCC)OCC |
| InChI | 1S/C11H16ClO4PS2/c1-3-15-17(13,16-4-2)18-9-19(14)11-7-5-10(12)6-8-11/h5-8H,3-4,9H2,1-2H3 |
| InChIKey | XQKGIZXBDUMZBY-UHFFFAOYSA-N |
| Density | 1.393g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.137°C at 760 mmHg (Cal.) |
| Flash point | 226.64°C (Cal.) |
| Refractive index | 1.58 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for S-{[(4-Chlorophenyl)Sulfinyl]Methyl} O,O-Diethyl Phosphorothioate |