|
CAS#: 16683-64-0 Product: Benz(k)Aceanthrylene No suppilers available for the product. |
| Name | Benz(k)Aceanthrylene |
|---|---|
| Synonyms | Benz(K)Aceanthrylene; Ccris 2991; Cyclopenta(De)Naphthacene |
| Molecular Structure | ![]() |
| Molecular Formula | C20H12 |
| Molecular Weight | 252.31 |
| CAS Registry Number | 16683-64-0 |
| SMILES | C2=C4C(=C1C3=C(C=C1)C=CC=C23)C=C5C(=C4)C=CC=C5 |
| InChI | 1S/C20H12/c1-2-5-15-12-19-17(10-14(15)4-1)11-16-7-3-6-13-8-9-18(19)20(13)16/h1-12H |
| InChIKey | PYSSVKADNGCTPT-UHFFFAOYSA-N |
| Density | 1.284g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.503°C at 760 mmHg (Cal.) |
| Flash point | 247.065°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Benz(k)Aceanthrylene |