|
CAS#: 16703-33-6 Product: 1-Methoxy-1,3,3-Trimethyl-1,3-Dihydro-2-Benzofuran No suppilers available for the product. |
| Name | 1-Methoxy-1,3,3-Trimethyl-1,3-Dihydro-2-Benzofuran |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.25 |
| CAS Registry Number | 16703-33-6 |
| SMILES | O(C2(OC(c1ccccc12)(C)C)C)C |
| InChI | 1S/C12H16O2/c1-11(2)9-7-5-6-8-10(9)12(3,13-4)14-11/h5-8H,1-4H3 |
| InChIKey | OMOOEIURIVHTEF-UHFFFAOYSA-N |
| Density | 1.051g/cm3 (Cal.) |
|---|---|
| Boiling point | 255.637°C at 760 mmHg (Cal.) |
| Flash point | 91.439°C (Cal.) |
| Refractive index | 1.524 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Methoxy-1,3,3-Trimethyl-1,3-Dihydro-2-Benzofuran |