|
CAS#: 16720-04-0 Product: 7,8,9,10-Tetrahydro-6,6-Dimethyl-2-Chloro-6H-Dibenzo[b,d]Pyran-3-Ol No suppilers available for the product. |
| Name | 7,8,9,10-Tetrahydro-6,6-Dimethyl-2-Chloro-6H-Dibenzo[b,d]Pyran-3-Ol |
|---|---|
| Synonyms | 6H-Dibenzo(B,D)Pyran-3-Ol, 2-Chloro-6,6-Dimethyl-7,8,9,10-Tetrahydro-; 2-Chloro-6,6-Dimethyl-7,8,9,10-Tetrahydro-6H-Dibenzo(B,D)Pyran-3-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C15H17ClO2 |
| Molecular Weight | 264.75 |
| CAS Registry Number | 16720-04-0 |
| SMILES | C1=C(Cl)C(=CC2=C1C3=C(C(O2)(C)C)CCCC3)O |
| InChI | 1S/C15H17ClO2/c1-15(2)11-6-4-3-5-9(11)10-7-12(16)13(17)8-14(10)18-15/h7-8,17H,3-6H2,1-2H3 |
| InChIKey | HVPGANLUVNQMME-UHFFFAOYSA-N |
| Density | 1.276g/cm3 (Cal.) |
|---|---|
| Boiling point | 396.055°C at 760 mmHg (Cal.) |
| Flash point | 193.327°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 7,8,9,10-Tetrahydro-6,6-Dimethyl-2-Chloro-6H-Dibenzo[b,d]Pyran-3-Ol |