|
CAS#: 16721-38-3 Product: cis-6-(Isopropyl)-3-Methylcyclohex-2-En-1-Ol No suppilers available for the product. |
| Name | cis-6-(Isopropyl)-3-Methylcyclohex-2-En-1-Ol |
|---|---|
| Synonyms | (1R,6S)-6-Isopropyl-3-Methyl-Cyclohex-2-En-1-Ol; (1R,6S)-6-Isopropyl-3-Methyl-1-Cyclohex-2-Enol; (1R,6S)-3-Methyl-6-Propan-2-Yl-Cyclohex-2-En-1-Ol |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 |
| CAS Registry Number | 16721-38-3 |
| EINECS | 240-775-4 |
| SMILES | [C@@H]1([C@@H](O)C=C(CC1)C)C(C)C |
| InChI | 1S/C10H18O/c1-7(2)9-5-4-8(3)6-10(9)11/h6-7,9-11H,4-5H2,1-3H3/t9-,10-/m0/s1 |
| InChIKey | HPOHAUWWDDPHRS-UWVGGRQHSA-N |
| Density | 0.925g/cm3 (Cal.) |
|---|---|
| Boiling point | 222.665°C at 760 mmHg (Cal.) |
| Flash point | 89.838°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for cis-6-(Isopropyl)-3-Methylcyclohex-2-En-1-Ol |