Online Database of Chemicals from Around the World
| Name | 4,5-Dimethylbenzo[a]Pyrene |
|---|---|
| Synonyms | 4,5-Dimethylbenzo(A)Pyrene; 4-05-00-02704 (Beilstein Handbook Reference); Benzo(A)Pyrene, 4,5-Dimethyl- |
| Molecular Structure | ![CAS#: 16757-89-4, 4,5-Dimethylbenzo[a]Pyrene](/moreStructures/16757-89-4.gif) |
| Molecular Formula | C22H16 |
| Molecular Weight | 280.37 |
| CAS Registry Number | 16757-89-4 |
| SMILES | C1=CC4=C3C2=C1C5=C(C=C2C(=C(C3=CC=C4)C)C)C=CC=C5 |
| InChI | 1S/C22H16/c1-13-14(2)20-12-16-6-3-4-8-18(16)19-11-10-15-7-5-9-17(13)21(15)22(19)20/h3-12H,1-2H3 |
| InChIKey | KWYWGXYFWOWWTF-UHFFFAOYSA-N |
| Density | 1.226g/cm3 (Cal.) |
|---|---|
| Boiling point | 495.53°C at 760 mmHg (Cal.) |
| Flash point | 247.441°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,5-Dimethylbenzo[a]Pyrene |
