|
CAS#: 1693-44-3 Product: 2,2,4,4,6,6-Hexamethyl-8,8-Diphenylcyclotetrasiloxane No suppilers available for the product. |
| Name | 2,2,4,4,6,6-Hexamethyl-8,8-Diphenylcyclotetrasiloxane |
|---|---|
| Synonyms | 2,2,4,4,6,6-Hexamethyl-8,8-Diphenylcyclotetrasiloxane; 2,2,4,4,6,6-Hexamethyl-8,8-Diphenyl-[1,3,5,7,2,4,6,8]Cyclotetrasiloxane |
| Molecular Structure | ![]() |
| Molecular Formula | C18H28O4Si4 |
| Molecular Weight | 420.76 |
| CAS Registry Number | 1693-44-3 |
| EINECS | 216-895-8 |
| SMILES | C3=C([Si]1(O[Si](O[Si](O[Si](O1)(C)C)(C)C)(C)C)C2=CC=CC=C2)C=CC=C3 |
| InChI | 1S/C18H28O4Si4/c1-23(2)19-24(3,4)21-26(22-25(5,6)20-23,17-13-9-7-10-14-17)18-15-11-8-12-16-18/h7-16H,1-6H3 |
| InChIKey | BOIFXPDTOHPTOD-UHFFFAOYSA-N |
| Density | 1.062g/cm3 (Cal.) |
|---|---|
| Boiling point | 353.87°C at 760 mmHg (Cal.) |
| Flash point | 146.032°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2,4,4,6,6-Hexamethyl-8,8-Diphenylcyclotetrasiloxane |