|
CAS#: 16981-83-2 Product: Hydroxyperezone No suppilers available for the product. |
| Name | Hydroxyperezone |
|---|---|
| Synonyms | 2-[(1R)-1,5-Dimethylhex-4-Enyl]-3,6-Dihydroxy-5-Methyl-1,4-Benzoquinone; 2-[(1R)-1,5-Dimethylhex-4-Enyl]-3,6-Dihydroxy-5-Methyl-P-Benzoquinone; 2,5-Cyclohexadiene-1,4-Dione, 2-(1,5-Dimethyl-4-Hexenyl)-3,6-Dihydroxy-5-Methyl-, (R)- |
| Molecular Structure | ![]() |
| Molecular Formula | C15H20O4 |
| Molecular Weight | 264.32 |
| CAS Registry Number | 16981-83-2 |
| SMILES | [C@H](C1=C(C(=O)C(=C(C1=O)O)C)O)(CCC=C(C)C)C |
| InChI | 1S/C15H20O4/c1-8(2)6-5-7-9(3)11-14(18)12(16)10(4)13(17)15(11)19/h6,9,16,19H,5,7H2,1-4H3/t9-/m1/s1 |
| InChIKey | QBLNXRHAHZPPDO-SECBINFHSA-N |
| Density | 1.201g/cm3 (Cal.) |
|---|---|
| Boiling point | 398.724°C at 760 mmHg (Cal.) |
| Flash point | 209.103°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Hydroxyperezone |