|
CAS#: 17045-97-5 Product: 1-Nitroso-4-Propyl-2,3-Dihydrophthalazine No suppilers available for the product. |
| Name | 1-Nitroso-4-Propyl-2,3-Dihydrophthalazine |
|---|---|
| Synonyms | Prothazaminol |
| Molecular Structure | ![]() |
| Molecular Formula | C11H13N3O |
| Molecular Weight | 203.24 |
| CAS Registry Number | 17045-97-5 |
| SMILES | C(C1=C2C(=C(NN1)N=O)C=CC=C2)CC |
| InChI | 1S/C11H13N3O/c1-2-5-10-8-6-3-4-7-9(8)11(14-15)13-12-10/h3-4,6-7,12-13H,2,5H2,1H3 |
| InChIKey | GYZZGTRBZPIVKD-UHFFFAOYSA-N |
| Density | 1.245g/cm3 (Cal.) |
|---|---|
| Boiling point | 352.255°C at 760 mmHg (Cal.) |
| Flash point | 166.838°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitroso-4-Propyl-2,3-Dihydrophthalazine |