|
CAS#: 17049-65-9 Product: 2-Phenyl-1,2-Dihydro-3H-Indazole-3-One No suppilers available for the product. |
| Name | 2-Phenyl-1,2-Dihydro-3H-Indazole-3-One |
|---|---|
| Synonyms | 2-Phenylindazolin-3-One; 3-Indazolinone, 2-Phenyl-; 3H-Indazol-3-One, 1,2-Dihydro-2-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.23 |
| CAS Registry Number | 17049-65-9 |
| SMILES | C1=CC2=C(C=C1)C(=O)N(N2)C3=CC=CC=C3 |
| InChI | 1S/C13H10N2O/c16-13-11-8-4-5-9-12(11)14-15(13)10-6-2-1-3-7-10/h1-9,14H |
| InChIKey | CFNJFZDGHGYAMU-UHFFFAOYSA-N |
| Density | 1.264g/cm3 (Cal.) |
|---|---|
| Boiling point | 360.788°C at 760 mmHg (Cal.) |
| Flash point | 171.999°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Phenyl-1,2-Dihydro-3H-Indazole-3-One |