|
CAS#: 17057-98-6 Product: 1,9-Dimethylfluorene No suppilers available for the product. |
| Name | 1,9-Dimethylfluorene |
|---|---|
| Synonyms | Dimethyl-9H-Fluorene; Fluorene, Dimethyl-; 1,9-Dimethylfluorene |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14 |
| Molecular Weight | 194.28 |
| CAS Registry Number | 17057-98-6 |
| SMILES | C1=CC2=C(C=C1)C(C)C3=C(C=CC=C23)C |
| InChI | 1S/C15H14/c1-10-6-5-9-14-13-8-4-3-7-12(13)11(2)15(10)14/h3-9,11H,1-2H3 |
| InChIKey | BNGCFLDEAHJKPE-UHFFFAOYSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 319.575°C at 760 mmHg (Cal.) |
| Flash point | 153.199°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,9-Dimethylfluorene |