|
CAS#: 17113-79-0 Product: Trimethyl[4-(Methylthio)Phenyl]-Stannane No suppilers available for the product. |
| Name | Trimethyl[4-(Methylthio)Phenyl]-Stannane |
|---|---|
| Synonyms | Trimethyl-[4-(Methylthio)Phenyl]Stannane; Stannane,Trimethyl[4-(Methylthio)Phenyl]-; Stannane, Trimethyl(4-(Methylthio)Phenyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C10H16SSn |
| Molecular Weight | 286.99 |
| CAS Registry Number | 17113-79-0 |
| SMILES | C1=CC(=CC=C1SC)[Sn](C)(C)C |
| InChI | 1S/C7H7S.3CH3.Sn/c1-8-7-5-3-2-4-6-7;;;;/h3-6H,1H3;3*1H3; |
| InChIKey | SOIHJVVPLRYXFC-UHFFFAOYSA-N |
| Boiling point | 274.836°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 120.017°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trimethyl[4-(Methylthio)Phenyl]-Stannane |