|
CAS#: 17114-78-2 Product: 9-(1,1-Dimethylethyl)-9H-Fluorene No suppilers available for the product. |
| Name | 9-(1,1-Dimethylethyl)-9H-Fluorene |
|---|---|
| Synonyms | 9-(1,1-Dimethylethyl)-9H-Fluorene |
| Molecular Structure | ![]() |
| Molecular Formula | C17H18 |
| Molecular Weight | 222.33 |
| CAS Registry Number | 17114-78-2 |
| SMILES | C1=CC=CC2=C1C(C(C)(C)C)C3=C2C=CC=C3 |
| InChI | 1S/C17H18/c1-17(2,3)16-14-10-6-4-8-12(14)13-9-5-7-11-15(13)16/h4-11,16H,1-3H3 |
| InChIKey | FGGPKIIPWXUABP-UHFFFAOYSA-N |
| Density | 1.036g/cm3 (Cal.) |
|---|---|
| Boiling point | 331.576°C at 760 mmHg (Cal.) |
| Flash point | 162.491°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9-(1,1-Dimethylethyl)-9H-Fluorene |