|
CAS#: 17122-21-3 Product: 1-Nitro-3-Nitrosobenzene No suppilers available for the product. |
| Name | 1-Nitro-3-Nitrosobenzene |
|---|---|
| Synonyms | 1-Nitro-3-Nitroso-Benzene; 3-Nitrosonitrobenzene; Benzene, 1-Nitro-3-Nitroso- |
| Molecular Structure | ![]() |
| Molecular Formula | C6H4N2O3 |
| Molecular Weight | 152.11 |
| CAS Registry Number | 17122-21-3 |
| SMILES | C1=C(N=O)C=CC=C1[N+]([O-])=O |
| InChI | 1S/C6H4N2O3/c9-7-5-2-1-3-6(4-5)8(10)11/h1-4H |
| InChIKey | DEQKNNCVTAXLKX-UHFFFAOYSA-N |
| Density | 1.41g/cm3 (Cal.) |
|---|---|
| Boiling point | 275.381°C at 760 mmHg (Cal.) |
| Flash point | 120.347°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-Nitro-3-Nitrosobenzene |