|
CAS#: 171522-36-4 Product: 3,3-Dimethyl-2,4-Dihydrobenzo[h]Chromene-5,6-Dione No suppilers available for the product. |
| Name | 3,3-Dimethyl-2,4-Dihydrobenzo[h]Chromene-5,6-Dione |
|---|---|
| Synonyms | 3,3-Dimethyl-2,4-Dihydrobenzo[H]Chromene-5,6-Quinone; Rhinacanthone |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14O3 |
| Molecular Weight | 242.27 |
| CAS Registry Number | 171522-36-4 |
| SMILES | C2=C1C3=C(C(=O)C(C1=CC=C2)=O)CC(C)(C)CO3 |
| InChI | 1S/C15H14O3/c1-15(2)7-11-13(17)12(16)9-5-3-4-6-10(9)14(11)18-8-15/h3-6H,7-8H2,1-2H3 |
| InChIKey | GAQRLJKQPBBUSK-UHFFFAOYSA-N |
| Density | 1.252g/cm3 (Cal.) |
|---|---|
| Boiling point | 381.4°C at 760 mmHg (Cal.) |
| Flash point | 169.736°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dimethyl-2,4-Dihydrobenzo[h]Chromene-5,6-Dione |