|
CAS#: 17191-65-0 Product: 5-[Bis(2-Chloroethyl)Amino]-M-Toluic Acid No suppilers available for the product. |
| Name | 5-[Bis(2-Chloroethyl)Amino]-M-Toluic Acid |
|---|---|
| Synonyms | 3-[Bis(2-Chloroethyl)Amino]-5-Methyl-Benzoic Acid; 5-Bis(2-Chloroethyl)Amino-3-Methylbenzoic Acid; 5-Bis(2-Chloroethyl)Amino-M-Toluic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C12H15Cl2NO2 |
| Molecular Weight | 276.16 |
| CAS Registry Number | 17191-65-0 |
| SMILES | C1=C(C=C(C=C1C)C(O)=O)N(CCCl)CCCl |
| InChI | 1S/C12H15Cl2NO2/c1-9-6-10(12(16)17)8-11(7-9)15(4-2-13)5-3-14/h6-8H,2-5H2,1H3,(H,16,17) |
| InChIKey | XUOHIEMVNRNKFP-UHFFFAOYSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 451.017°C at 760 mmHg (Cal.) |
| Flash point | 226.567°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-[Bis(2-Chloroethyl)Amino]-M-Toluic Acid |