|
CAS#: 17197-61-4 Product: 3-Benzyl-3-Phenylazetidin-2-One No suppilers available for the product. |
| Name | 3-Benzyl-3-Phenylazetidin-2-One |
|---|---|
| Synonyms | 3-Phenyl-3-(Phenylmethyl)-2-Azetidinone; 3-(Benzyl)-3-Phenyl-Azetidin-2-One; 2-Azetidinone, 3-Benzyl-3-Phenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C16H15NO |
| Molecular Weight | 237.30 |
| CAS Registry Number | 17197-61-4 |
| SMILES | C1=CC=CC=C1C3(CC2=CC=CC=C2)C(NC3)=O |
| InChI | 1S/C16H15NO/c18-15-16(12-17-15,14-9-5-2-6-10-14)11-13-7-3-1-4-8-13/h1-10H,11-12H2,(H,17,18) |
| InChIKey | MNAKQZFPMNVHMW-UHFFFAOYSA-N |
| Density | 1.161g/cm3 (Cal.) |
|---|---|
| Boiling point | 444.23°C at 760 mmHg (Cal.) |
| Flash point | 267.665°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Benzyl-3-Phenylazetidin-2-One |