|
CAS#: 17291-84-8 Product: N-(2,6-Dimethylphenethyl)Urea No suppilers available for the product. |
| Name | N-(2,6-Dimethylphenethyl)Urea |
|---|---|
| Synonyms | 2,6-Dimethylphenethylurea; Brn 2104341; Urea, 1-(2,6-Dimethylphenethyl)- |
| Molecular Structure | ![]() |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 |
| CAS Registry Number | 17291-84-8 |
| SMILES | C1=CC(=C(C(=C1)C)CCNC(=O)N)C |
| InChI | 1S/C11H16N2O/c1-8-4-3-5-9(2)10(8)6-7-13-11(12)14/h3-5H,6-7H2,1-2H3,(H3,12,13,14) |
| InChIKey | PIMJYOORDYDRBD-UHFFFAOYSA-N |
| Density | 1.063g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.788°C at 760 mmHg (Cal.) |
| Flash point | 157.484°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(2,6-Dimethylphenethyl)Urea |