|
CAS#: 1730-44-5 Product: 2-Chloro-7-Methoxy-10H-Phenothiazine No suppilers available for the product. |
| Name | 2-Chloro-7-Methoxy-10H-Phenothiazine |
|---|---|
| Synonyms | 10H-Phenothiazine, 2-Chloro-7-Methoxy-; 2-Chloro-7-Methoxyphenothiazine; Nsc516783 |
| Molecular Structure | ![]() |
| Molecular Formula | C13H10ClNOS |
| Molecular Weight | 263.74 |
| CAS Registry Number | 1730-44-5 |
| SMILES | C1=C(OC)C=CC2=C1SC3=C(N2)C=C(Cl)C=C3 |
| InChI | 1S/C13H10ClNOS/c1-16-9-3-4-10-13(7-9)17-12-5-2-8(14)6-11(12)15-10/h2-7,15H,1H3 |
| InChIKey | VGCKEWCZFDSELD-UHFFFAOYSA-N |
| Density | 1.335g/cm3 (Cal.) |
|---|---|
| Boiling point | 433.332°C at 760 mmHg (Cal.) |
| Flash point | 215.871°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-7-Methoxy-10H-Phenothiazine |