|
CAS#: 17322-34-8 Product: 2-Nitro-1-Phenylpropane No suppilers available for the product. |
| Name | 2-Nitro-1-Phenylpropane |
|---|---|
| Synonyms | 1-Phenyl-2-Nitropropane; Benzene, (2-Nitropropyl)- (8Ci)(9Ci); Nsc 16191 |
| Molecular Structure | ![]() |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 |
| CAS Registry Number | 17322-34-8 |
| SMILES | C1=CC=CC=C1CC(C)[N+]([O-])=O |
| InChI | 1S/C9H11NO2/c1-8(10(11)12)7-9-5-3-2-4-6-9/h2-6,8H,7H2,1H3 |
| InChIKey | OQBJLKIDAPUHSY-UHFFFAOYSA-N |
| Density | 1.087g/cm3 (Cal.) |
|---|---|
| Boiling point | 267.949°C at 760 mmHg (Cal.) |
| Flash point | 117.384°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Nitro-1-Phenylpropane |