|
CAS#: 17323-81-8 Product: Disodium Methyl Phosphate No suppilers available for the product. |
| Name | Disodium Methyl Phosphate |
|---|---|
| Synonyms | Disodium Methyl Phosphate |
| Molecular Structure | ![]() |
| Molecular Formula | CH3Na2O4P |
| Molecular Weight | 155.99 |
| CAS Registry Number | 17323-81-8 |
| EINECS | 241-345-9 |
| SMILES | CO[P]([O-])([O-])=O.[Na+].[Na+] |
| InChI | 1S/CH5O4P.2Na/c1-5-6(2,3)4;;/h1H3,(H2,2,3,4);;/q;2*+1/p-2 |
| InChIKey | MBTOOKBKBYXTCE-UHFFFAOYSA-L |
| Boiling point | 250.1°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 105°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Disodium Methyl Phosphate |