|
CAS#: 17337-22-3 Product: 1-(Hydroxymethyl)-beta-Carboline No suppilers available for the product. |
| Name | 1-(Hydroxymethyl)-beta-Carboline |
|---|---|
| Synonyms | 9H-$B-Carbolin-1-Ylmethanol; 9H-Beta-Carbolin-1-Ylmethanol; 9H-Pyrido[3,4-B]Indole-1-Methanol |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N2O |
| Molecular Weight | 198.22 |
| CAS Registry Number | 17337-22-3 |
| SMILES | C1=CN=C(C2=C1C3=C([NH]2)C=CC=C3)CO |
| InChI | 1S/C12H10N2O/c15-7-11-12-9(5-6-13-11)8-3-1-2-4-10(8)14-12/h1-6,14-15H,7H2 |
| InChIKey | XKCXIUDPGSNQIQ-UHFFFAOYSA-N |
| Density | 1.386g/cm3 (Cal.) |
|---|---|
| Boiling point | 466.03°C at 760 mmHg (Cal.) |
| Flash point | 235.647°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(Hydroxymethyl)-beta-Carboline |