|
CAS#: 173908-49-1 Product: 1-(2-Chlorophenyl)Sulfonylpyrrole-2-Carboxylic Acid No suppilers available for the product. |
| Name | 1-(2-Chlorophenyl)Sulfonylpyrrole-2-Carboxylic Acid |
|---|---|
| Synonyms | 1-(2-Chlorophenyl)Sulfonyl-2-Pyrrolecarboxylic Acid; Aids043497; 1-(2-(Chlorophenyl)Sulfonyl)-1H-Pyrrole-2-Carboxylic Acid |
| Molecular Structure | ![]() |
| Molecular Formula | C11H8ClNO4S |
| Molecular Weight | 285.70 |
| CAS Registry Number | 173908-49-1 |
| SMILES | C1=C(C(O)=O)[N](C=C1)[S](=O)(=O)C2=C(C=CC=C2)Cl |
| InChI | 1S/C11H8ClNO4S/c12-8-4-1-2-6-10(8)18(16,17)13-7-3-5-9(13)11(14)15/h1-7H,(H,14,15) |
| InChIKey | VNSHVIMXDPKVOQ-UHFFFAOYSA-N |
| Density | 1.522g/cm3 (Cal.) |
|---|---|
| Boiling point | 529.837°C at 760 mmHg (Cal.) |
| Flash point | 274.236°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1-(2-Chlorophenyl)Sulfonylpyrrole-2-Carboxylic Acid |