|
CAS#: 17429-38-8 Product: 3-Methyl-4,4-Diphenyl-2-Cyclohexen-1-One No suppilers available for the product. |
| Name | 3-Methyl-4,4-Diphenyl-2-Cyclohexen-1-One |
|---|---|
| Synonyms | 3-Methyl-4,4-diphenyl-2-cyclohexen-1-one # |
| Molecular Structure | ![]() |
| Molecular Formula | C19H18O |
| Molecular Weight | 262.35 |
| CAS Registry Number | 17429-38-8 |
| SMILES | O=C3\C=C(/C(c1ccccc1)(c2ccccc2)CC3)C |
| InChI | 1S/C19H18O/c1-15-14-18(20)12-13-19(15,16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,14H,12-13H2,1H3 |
| InChIKey | CMXNJGONQDQMQE-UHFFFAOYSA-N |
| Density | 1.088g/cm3 (Cal.) |
|---|---|
| Boiling point | 321.505°C at 760 mmHg (Cal.) |
| Flash point | 150.051°C (Cal.) |
| Refractive index | 1.586 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Methyl-4,4-Diphenyl-2-Cyclohexen-1-One |