|
CAS#: 17449-92-2 Product: 16-alpha-Bromo-20-Oxopregn-5-En-3-beta-Yl Acetate No suppilers available for the product. |
| Name | 16-alpha-Bromo-20-Oxopregn-5-En-3-beta-Yl Acetate |
|---|---|
| Synonyms | Acetic Acid (17-Acetyl-16-Bromo-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ester; (16-Bromo-17-Ethanoyl-10,13-Dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-Dodecahydro-1H-Cyclopenta[A]Phenanthren-3-Yl) Ethanoate; Nsc226882 |
| Molecular Structure | ![]() |
| Molecular Formula | C23H33BrO3 |
| Molecular Weight | 437.42 |
| CAS Registry Number | 17449-92-2 |
| EINECS | 241-465-1 |
| SMILES | CC34C(C1C(C2(C(=CC1)CC(OC(=O)C)CC2)C)CC3)CC(Br)C4C(=O)C |
| InChI | 1S/C23H33BrO3/c1-13(25)21-20(24)12-19-17-6-5-15-11-16(27-14(2)26)7-9-22(15,3)18(17)8-10-23(19,21)4/h5,16-21H,6-12H2,1-4H3 |
| InChIKey | USMVITRIRORNNZ-UHFFFAOYSA-N |
| Density | 1.28g/cm3 (Cal.) |
|---|---|
| Boiling point | 492.011°C at 760 mmHg (Cal.) |
| Flash point | 251.359°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 16-alpha-Bromo-20-Oxopregn-5-En-3-beta-Yl Acetate |