|
CAS#: 17508-29-1 Product: 4-(Allylseleno)-1-Chlorobenzene No suppilers available for the product. |
| Name | 4-(Allylseleno)-1-Chlorobenzene |
|---|---|
| Synonyms | 1-Allylselanyl-4-Chloro-Benzene; 1-(Allylseleno)-4-Chlorobenzene; 1-(Allylseleno)-4-Chloro-Benzene |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9ClSe |
| Molecular Weight | 231.58 |
| CAS Registry Number | 17508-29-1 |
| EINECS | 241-513-1 |
| SMILES | C1=C([Se]CC=C)C=CC(=C1)Cl |
| InChI | 1S/C9H9ClSe/c1-2-7-11-9-5-3-8(10)4-6-9/h2-6H,1,7H2 |
| InChIKey | YPYNRHWRFOGAGS-UHFFFAOYSA-N |
| Boiling point | 258.897°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 110.377°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(Allylseleno)-1-Chlorobenzene |