|
CAS#: 175205-83-1 Product: Ethyl 8-(Chloromethyl)-4H-1,3-Benzodioxine-6-Carboxylate No suppilers available for the product. |
| Name | Ethyl 8-(Chloromethyl)-4H-1,3-Benzodioxine-6-Carboxylate |
|---|---|
| Synonyms | 4H-1,3-Be |
| Molecular Structure | ![]() |
| Molecular Formula | C12H13ClO4 |
| Molecular Weight | 256.68 |
| CAS Registry Number | 175205-83-1 |
| SMILES | CCOC(=O)c1cc2c(c(c1)CCl)OCOC2 |
| InChI | 1S/C12H13ClO4/c1-2-16-12(14)8-3-9(5-13)11-10(4-8)6-15-7-17-11/h3-4H,2,5-7H2,1H3 |
| InChIKey | UCLANRMZSVEDLN-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 425.2±45.0°C at 760 mmHg (Cal.) |
| Flash point | 182.7±27.7°C (Cal.) |
| Refractive index | 1.543 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Ethyl 8-(Chloromethyl)-4H-1,3-Benzodioxine-6-Carboxylate |