|
CAS#: 175606-23-2 Product: 2-{[5-(2-Amino-5-Iodophenyl)-5-Oxopentyl]Amino}-N-(1-Cyclohexen-1-Yl)-2-Phenylacetamide No suppilers available for the product. |
| Name | 2-{[5-(2-Amino-5-Iodophenyl)-5-Oxopentyl]Amino}-N-(1-Cyclohexen-1-Yl)-2-Phenylacetamide |
|---|---|
| Synonyms | 2-{[5-(2- |
| Molecular Structure | ![]() |
| Molecular Formula | C25H30IN3O2 |
| Molecular Weight | 531.43 |
| CAS Registry Number | 175606-23-2 |
| SMILES | c1ccc(cc1)C(C(=O)NC2=CCCCC2)NCCCCC(=O)c3cc(ccc3N)I |
| InChI | 1S/C25H30IN3O2/c26-19-14-15-22(27)21(17-19)23(30)13-7-8-16-28-24(18-9-3-1-4-10-18)25(31)29-20-11-5-2-6-12-20/h1,3-4,9-11,14-15,17,24,28H,2,5-8,12-13,16,27H2,(H,29,31) |
| InChIKey | CEFBZYMOLVQGRN-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 704.5±60.0°C at 760 mmHg (Cal.) |
| Flash point | 379.9±32.9°C (Cal.) |
| Refractive index | 1.644 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-{[5-(2-Amino-5-Iodophenyl)-5-Oxopentyl]Amino}-N-(1-Cyclohexen-1-Yl)-2-Phenylacetamide |