|
CAS#: 1760-27-6 Product: 8-Isopropenyl-2-furo[2,3-h]chromenone No suppilers available for the product. |
| Name | 8-Isopropenyl-2-furo[2,3-h]chromenone |
|---|---|
| Synonyms | 8-Isopropenylfuro[2,3-H]Chromen-2-One; 8-Isopropenyl-2-Furo[2,3-H]Chromenone; 2H-Furo[2,3-H]-1-Benzopyran-2-One, 8-Isopropenyl- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H10O3 |
| Molecular Weight | 226.23 |
| CAS Registry Number | 1760-27-6 |
| SMILES | C1=C(C(C)=C)OC2=C1C3=C(C=C2)C=CC(O3)=O |
| InChI | 1S/C14H10O3/c1-8(2)12-7-10-11(16-12)5-3-9-4-6-13(15)17-14(9)10/h3-7H,1H2,2H3 |
| InChIKey | FQCPXIJRWHRHIP-UHFFFAOYSA-N |
| Density | 1.258g/cm3 (Cal.) |
|---|---|
| Boiling point | 399.194°C at 760 mmHg (Cal.) |
| Flash point | 195.226°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 8-Isopropenyl-2-furo[2,3-h]chromenone |