|
CAS#: 17771-42-5 Product: 3-(Dimethylallyl)Indole No suppilers available for the product. |
| Name | 3-(Dimethylallyl)Indole |
|---|---|
| Synonyms | 3-(1,1-Dimethylprop-2-Enyl)-1H-Indole; 1H-Indole, 3-(3-Methyl-2-Butenyl)-; 3-(Dimethylallyl)Indole |
| Molecular Structure | ![]() |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 |
| CAS Registry Number | 17771-42-5 |
| SMILES | C1=C(C2=C([NH]1)C=CC=C2)C(C=C)(C)C |
| InChI | 1S/C13H15N/c1-4-13(2,3)11-9-14-12-8-6-5-7-10(11)12/h4-9,14H,1H2,2-3H3 |
| InChIKey | FWMYRLDYKNELFI-UHFFFAOYSA-N |
| Density | 1.028g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.61°C at 760 mmHg (Cal.) |
| Flash point | 130.464°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(Dimethylallyl)Indole |