Online Database of Chemicals from Around the World
|
CAS#: 17774-72-0 Product: 1,3-Bis[(4-Butylphenyl)Methyl]-1H-Imidazolium Chloride No suppilers available for the product. |
| Name | 1,3-Bis[(4-Butylphenyl)Methyl]-1H-Imidazolium Chloride |
|---|---|
| Synonyms | 1,3-Bis(4-Butylbenzyl)Imidazol-1-Ium Chloride; 1,3-Bis((4-Butylphenyl)Methyl)-1H-Imidazolium Chloride |
| Molecular Structure | ![CAS#: 17774-72-0, 1,3-Bis[(4-Butylphenyl)Methyl]-1H-Imidazolium Chloride](/moreStructures/17774-72-0.gif) |
| Molecular Formula | C25H33ClN2 |
| Molecular Weight | 397.00 |
| CAS Registry Number | 17774-72-0 |
| EINECS | 241-757-9 |
| SMILES | C2=[N+](CC1=CC=C(CCCC)C=C1)C=C[N]2CC3=CC=C(CCCC)C=C3.[Cl-] |
| InChI | 1S/C25H33N2.ClH/c1-3-5-7-22-9-13-24(14-10-22)19-26-17-18-27(21-26)20-25-15-11-23(12-16-25)8-6-4-2;/h9-18,21H,3-8,19-20H2,1-2H3;1H/q+1;/p-1 |
| InChIKey | UYOYVNWMMLSEOM-UHFFFAOYSA-M |
| Market Analysis Reports |
| List of Reports Available for 1,3-Bis[(4-Butylphenyl)Methyl]-1H-Imidazolium Chloride |