|
CAS#: 178043-48-6 Product: 3-{2,6-Dichloro-4-[(3,3-Dichloro-2-Propen-1-Yl)Oxy]Phenoxy}-1-Propanol No suppilers available for the product. |
| Name | 3-{2,6-Dichloro-4-[(3,3-Dichloro-2-Propen-1-Yl)Oxy]Phenoxy}-1-Propanol |
|---|---|
| Synonyms | 1-PROPANO |
| Molecular Structure | ![]() |
| Molecular Formula | C12H12Cl4O3 |
| Molecular Weight | 346.03 |
| CAS Registry Number | 178043-48-6 |
| SMILES | Clc1cc(OC\C=C(/Cl)Cl)cc(Cl)c1OCCCO |
| InChI | 1S/C12H12Cl4O3/c13-9-6-8(18-5-2-11(15)16)7-10(14)12(9)19-4-1-3-17/h2,6-7,17H,1,3-5H2 |
| InChIKey | WJXVUDLJJISECG-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 475.866°C at 760 mmHg (Cal.) |
| Flash point | 241.595°C (Cal.) |
| Refractive index | 1.569 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-{2,6-Dichloro-4-[(3,3-Dichloro-2-Propen-1-Yl)Oxy]Phenoxy}-1-Propanol |