|
CAS#: 17814-46-9 Product: N'-Phenyl-N,N-Bis(Trimethylsilyl)-1,2-Ethanediamine No suppilers available for the product. |
| Name | N'-Phenyl-N,N-Bis(Trimethylsilyl)-1,2-Ethanediamine |
|---|---|
| Molecular Structure | ![]() |
| Molecular Formula | C14H28N2Si2 |
| Molecular Weight | 280.56 |
| CAS Registry Number | 17814-46-9 |
| SMILES | N(c1ccccc1)CCN([Si](C)(C)C)[Si](C)(C)C |
| InChI | 1S/C14H28N2Si2/c1-17(2,3)16(18(4,5)6)13-12-15-14-10-8-7-9-11-14/h7-11,15H,12-13H2,1-6H3 |
| InChIKey | NOQZOZOGULWLKP-UHFFFAOYSA-N |
| Density | 0.925g/cm3 (Cal.) |
|---|---|
| Boiling point | 337.141°C at 760 mmHg (Cal.) |
| Flash point | 157.697°C (Cal.) |
| Refractive index | 1.502 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N'-Phenyl-N,N-Bis(Trimethylsilyl)-1,2-Ethanediamine |