|
CAS#: 1784-68-5 Product: 1,2,3,7,8,9-Hexahydro-1,3-Dimethyl-2,8-Dithioxo-6H-Purin-6-One No suppilers available for the product. |
| Name | 1,2,3,7,8,9-Hexahydro-1,3-Dimethyl-2,8-Dithioxo-6H-Purin-6-One |
|---|---|
| Synonyms | 1,3-Dimethyl-2,8-Dithioxo-7,9-Dihydropurin-6-One; 2-Thio-8-Mercaptotheophylline; 6H-Purin-6-One, 1,2,3,7,8,9-Hexahydro-1,3-Dimethyl-2,8-Dithioxo- |
| Molecular Structure | ![]() |
| Molecular Formula | C7H8N4OS2 |
| Molecular Weight | 228.29 |
| CAS Registry Number | 1784-68-5 |
| SMILES | CN2C1=C(NC(=S)N1)C(=O)N(C2=S)C |
| InChI | 1S/C7H8N4OS2/c1-10-4-3(8-6(13)9-4)5(12)11(2)7(10)14/h1-2H3,(H2,8,9,13) |
| InChIKey | ICPOMCAMXKYSKE-UHFFFAOYSA-N |
| Density | 1.672g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.651°C at 760 mmHg (Cal.) |
| Flash point | 139.258°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,7,8,9-Hexahydro-1,3-Dimethyl-2,8-Dithioxo-6H-Purin-6-One |