|
CAS#: 17870-85-8 Product: 3',5-Dichlorodiphenylamine-2-Carboxylic Acid No suppilers available for the product. |
| Name | 3',5-Dichlorodiphenylamine-2-Carboxylic Acid |
|---|---|
| Synonyms | 3',5-Dichlorodiphenylamine-2-Carboxylic Acid; Benzoic Acid, 4-Chloro-2-((3-Chlorophenyl)Amino)-; Dcdpc |
| Molecular Structure | ![]() |
| Molecular Formula | C13H9Cl2NO2 |
| Molecular Weight | 282.13 |
| CAS Registry Number | 17870-85-8 |
| SMILES | C1=C(C=CC=C1Cl)NC2=C(C=CC(=C2)Cl)C(=O)O |
| InChI | 1S/C13H9Cl2NO2/c14-8-2-1-3-10(6-8)16-12-7-9(15)4-5-11(12)13(17)18/h1-7,16H,(H,17,18) |
| InChIKey | GSDQYSSLIKJJOG-UHFFFAOYSA-N |
| Density | 1.47g/cm3 (Cal.) |
|---|---|
| Boiling point | 420.2°C at 760 mmHg (Cal.) |
| Flash point | 207.93°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3',5-Dichlorodiphenylamine-2-Carboxylic Acid |