|
CAS#: 17874-33-8 Product: 4,8-Dimethyl-6-Tert-Butyl-Chromen-2-One No suppilers available for the product. |
| Name | 4,8-Dimethyl-6-Tert-Butyl-Chromen-2-One |
|---|---|
| Synonyms | 6-Tert-Butyl-4,8-Dimethyl-Chromen-2-One; 6-Tert-Butyl-4,8-Dimethyl-2-Chromenone; 6-Tert-Butyl-4,8-Dimethyl-Coumarin |
| Molecular Structure | ![]() |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 |
| CAS Registry Number | 17874-33-8 |
| SMILES | C1=C(C)C2=C(C=C1C(C)(C)C)C(=CC(O2)=O)C |
| InChI | 1S/C15H18O2/c1-9-7-13(16)17-14-10(2)6-11(8-12(9)14)15(3,4)5/h6-8H,1-5H3 |
| InChIKey | BQCUNTCSOSCBOV-UHFFFAOYSA-N |
| Density | 1.056g/cm3 (Cal.) |
|---|---|
| Boiling point | 345.609°C at 760 mmHg (Cal.) |
| Flash point | 143.77°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8-Dimethyl-6-Tert-Butyl-Chromen-2-One |