|
CAS#: 1788-93-8 Product: 3-(4-Chlorophenyl)-2-Methyl-4(3H)-Quinazolinon No suppilers available for the product. |
| Name | 3-(4-Chlorophenyl)-2-Methyl-4(3H)-Quinazolinon |
|---|---|
| Synonyms | 3-(4-Chlorophenyl)-2-Methyl-Quinazolin-4-One Hydrochloride; 3-(4-Chlorophenyl)-2-Methyl-4-Quinazolinone Hydrochloride; Chi 17 |
| Molecular Structure | ![]() |
| Molecular Formula | C15H12Cl2N2O |
| Molecular Weight | 307.18 |
| CAS Registry Number | 1788-93-8 |
| SMILES | [H+].C2=C1C(=O)N(C(=NC1=CC=C2)C)C3=CC=C(Cl)C=C3.[Cl-] |
| InChI | 1S/C15H11ClN2O.ClH/c1-10-17-14-5-3-2-4-13(14)15(19)18(10)12-8-6-11(16)7-9-12;/h2-9H,1H3;1H |
| InChIKey | MQACHEJMUZIGJY-UHFFFAOYSA-N |
| Boiling point | 439°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 219.3°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-(4-Chlorophenyl)-2-Methyl-4(3H)-Quinazolinon |