|
CAS#: 17977-09-2 Product: 2,2-Dinitropropyl Acrylate No suppilers available for the product. |
| Name | 2,2-Dinitropropyl Acrylate |
|---|---|
| Synonyms | Prop-2-Enoic Acid 2,2-Dinitropropyl Ester; Acrylic Acid 2,2-Dinitropropyl Ester; Nsc166462 |
| Molecular Structure | ![]() |
| Molecular Formula | C6H8N2O6 |
| Molecular Weight | 204.14 |
| CAS Registry Number | 17977-09-2 |
| EINECS | 241-897-0 |
| SMILES | C(C([N+](=O)[O-])([N+](=O)[O-])C)OC(C=C)=O |
| InChI | 1S/C6H8N2O6/c1-3-5(9)14-4-6(2,7(10)11)8(12)13/h3H,1,4H2,2H3 |
| InChIKey | BGPPMVLBKMPVQR-UHFFFAOYSA-N |
| Density | 1.345g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.583°C at 760 mmHg (Cal.) |
| Flash point | 146.025°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,2-Dinitropropyl Acrylate |