|
CAS#: 180-43-8 Product: Spiro[5.5]Undecane No suppilers available for the product. |
| Name | Spiro[5.5]Undecane |
|---|---|
| Synonyms | Inchi=1/C11h20/C1-3-7-11(8-4-1)9-5-2-6-10-11/H1-10H; Spiro(5.5)Undecane; Nsc106192 |
| Molecular Structure | ![]() |
| Molecular Formula | C11H20 |
| Molecular Weight | 152.28 |
| CAS Registry Number | 180-43-8 |
| SMILES | [C]12(CC[CH2]CC1)CC[CH2]CC2 |
| InChI | 1S/C11H20/c1-3-7-11(8-4-1)9-5-2-6-10-11/h1-10H2 |
| InChIKey | NECLQTPQJZSWOE-UHFFFAOYSA-N |
| Density | 0.879g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.883°C at 760 mmHg (Cal.) |
| Flash point | 71.761°C (Cal.) |
| (1) | Bo Jiang, Wen-Juan Hao, Jin-Peng Zhang, Shu-Jiang Tu and Feng Shi. A new domino autocatalytic reaction leading to polyfunctionalized spiro[5.5]undecanes and dispiro[4.2.5.2]pentadecanes, Org. Biomol. Chem., 2009, 7, 2195. |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Spiro[5.5]Undecane |