|
CAS#: 18030-61-0 Product: p-Trichlorosilylbiphenyl No suppilers available for the product. |
| Name | p-Trichlorosilylbiphenyl |
|---|---|
| Synonyms | P-Xenyltrichlorosilane; P-Trichlorosilylbiphenyl |
| Molecular Structure | ![]() |
| Molecular Formula | C12H9Cl3Si |
| Molecular Weight | 287.65 |
| CAS Registry Number | 18030-61-0 |
| SMILES | C1=CC=CC(=C1)C2=CC=C(C=C2)[Si](Cl)(Cl)Cl |
| InChI | 1S/C12H9Cl3Si/c13-16(14,15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h1-9H |
| InChIKey | DHCRMIWRXITVBB-UHFFFAOYSA-N |
| Density | 1.306g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.372°C at 760 mmHg (Cal.) |
| Flash point | 163.042°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for p-Trichlorosilylbiphenyl |