|
CAS#: 18063-89-3 Product: 2,5-Diethyl-4,5-Dihydro-2,5-Dimethyl-3(2H)-Furanone No suppilers available for the product. |
| Name | 2,5-Diethyl-4,5-Dihydro-2,5-Dimethyl-3(2H)-Furanone |
|---|---|
| Synonyms | 2,5-Diethyl-2,5-Dimethyl-Tetrahydrofuran-3-One; 2,5-Diethyl-2,5-Dimethyl-3-Tetrahydrofuranone; 2,5-Diethyl-2,5-Dimethyl-Oxolan-3-One |
| Molecular Structure | ![]() |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 |
| CAS Registry Number | 18063-89-3 |
| SMILES | C(C1(C(CC(O1)(CC)C)=O)C)C |
| InChI | 1S/C10H18O2/c1-5-9(3)7-8(11)10(4,6-2)12-9/h5-7H2,1-4H3 |
| InChIKey | ZRKCXPIUZAYNFE-UHFFFAOYSA-N |
| Density | 0.904g/cm3 (Cal.) |
|---|---|
| Boiling point | 219.689°C at 760 mmHg (Cal.) |
| Flash point | 74.258°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,5-Diethyl-4,5-Dihydro-2,5-Dimethyl-3(2H)-Furanone |