|
CAS#: 18118-80-4 Product: Oxisopred No suppilers available for the product. |
| Name | Oxisopred |
|---|---|
| Synonyms | 11Beta,17,21-Trihydroxy-B-Homo-A-Norpregn-1-Ene-3,6,20-Trione; B-Homo-A-Norpregn-1-Ene-3,6,20-Trione, 11Beta,17,21-Trihydroxy-; Oxisopred |
| Molecular Structure | ![]() |
| Molecular Formula | C21H28O6 |
| Molecular Weight | 376.45 |
| CAS Registry Number | 18118-80-4 |
| SMILES | [C@H]34C1[C@@H](C2(C(C(=O)CC1)C(=O)C=C2)C)C(O)CC3([C@](O)(CC4)C(OC)=O)C |
| InChI | 1S/C21H28O6/c1-19-8-7-14(23)17(19)13(22)5-4-11-12-6-9-21(26,18(25)27-3)20(12,2)10-15(24)16(11)19/h7-8,11-12,15-17,24,26H,4-6,9-10H2,1-3H3/t11?,12-,15?,16+,17?,19?,20?,21-/m0/s1 |
| InChIKey | KRYLHOFPHHPHIN-DLQOZDSXSA-N |
| Density | 1.296g/cm3 (Cal.) |
|---|---|
| Boiling point | 531.294°C at 760 mmHg (Cal.) |
| Flash point | 183.889°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Oxisopred |