|
CAS#: 18128-16-0 Product: 2-Chloro-4-Phenylphenol Potassium Salt No suppilers available for the product. |
| Name | 2-Chloro-4-Phenylphenol Potassium Salt |
|---|---|
| Synonyms | Potassium 2-Chloro-4-Phenyl-Phenolate; 2-Chloro-4-Phenylphenol Potassium Salt; 3-Chloro-(1,1'-Biphenyl)-4-Ol Potassium Salt |
| Molecular Structure | ![]() |
| Molecular Formula | C12H8ClKO |
| Molecular Weight | 242.75 |
| CAS Registry Number | 18128-16-0 |
| SMILES | C2=C(C1=CC=CC=C1)C=CC(=C2Cl)[O-].[K+] |
| InChI | 1S/C12H9ClO.K/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9;/h1-8,14H;/q;+1/p-1 |
| InChIKey | MUFFBVTZSRJQNG-UHFFFAOYSA-M |
| Boiling point | 317.4°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 145.8°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Chloro-4-Phenylphenol Potassium Salt |