|
CAS#: 1823-76-3 Product: 2-Hydroxyimino-1-(4-Methoxyphenyl)Ethanone No suppilers available for the product. |
| Name | 2-Hydroxyimino-1-(4-Methoxyphenyl)Ethanone |
|---|---|
| Synonyms | (2E)-2-Hydroxyimino-1-(4-Methoxyphenyl)Ethanone; 2-(4-Methoxyphenyl)-2-Oxo-Acetaldehyde Oxime; 2-(4-Methoxyphenyl)-2-Oxoacetaldehyde Oxime |
| Molecular Structure | ![]() |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.18 |
| CAS Registry Number | 1823-76-3 |
| SMILES | C1=C(C(\C=N\O)=O)C=CC(=C1)OC |
| InChI | 1S/C9H9NO3/c1-13-8-4-2-7(3-5-8)9(11)6-10-12/h2-6,12H,1H3/b10-6+ |
| InChIKey | LANIGOHQUOHJPR-UXBLZVDNSA-N |
| Density | 1.165g/cm3 (Cal.) |
|---|---|
| Boiling point | 364.51°C at 760 mmHg (Cal.) |
| Flash point | 174.25°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxyimino-1-(4-Methoxyphenyl)Ethanone |