|
CAS#: 18264-96-5 Product: 1,7-Dinitro-9,10-Dihydro-2-Phenanthrenamine No suppilers available for the product. |
| Name | 1,7-Dinitro-9,10-Dihydro-2-Phenanthrenamine |
|---|---|
| Synonyms | 1,7-Dinitro-9,10-dihydro-2-phenanthrenamine #; 2-Phenanthrylamine, 9,10-dihydro-1,7-dinitro- |
| Molecular Structure | ![]() |
| Molecular Formula | C14H11N3O4 |
| Molecular Weight | 285.25 |
| CAS Registry Number | 18264-96-5 |
| SMILES | [O-][N+](=O)c3ccc2c1c(c(c(cc1)N)[N+]([O-])=O)CCc2c3 |
| InChI | 1S/C14H11N3O4/c15-13-6-5-11-10-4-2-9(16(18)19)7-8(10)1-3-12(11)14(13)17(20)21/h2,4-7H,1,3,15H2 |
| InChIKey | GJMTYQYKDZHAKK-UHFFFAOYSA-N |
| Density | 1.485g/cm3 (Cal.) |
|---|---|
| Boiling point | 537.818°C at 760 mmHg (Cal.) |
| Flash point | 279.062°C (Cal.) |
| Refractive index | 1.719 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Dinitro-9,10-Dihydro-2-Phenanthrenamine |