|
CAS#: 18277-91-3 Product: Azobenzene-2-Carboxylic Acid Ethyl Ester No suppilers available for the product. |
| Name | Azobenzene-2-Carboxylic Acid Ethyl Ester |
|---|---|
| Synonyms | Ethyl 2-Phenylazobenzoate; 2-Phenylazobenzoic Acid Ethyl Ester; Benzoic Acid, 2-(Phenylazo)-, Ethyl Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 |
| CAS Registry Number | 18277-91-3 |
| SMILES | C1=CC=C(C=C1)N=NC2=C(C=CC=C2)C(=O)OCC |
| InChI | 1S/C15H14N2O2/c1-2-19-15(18)13-10-6-7-11-14(13)17-16-12-8-4-3-5-9-12/h3-11H,2H2,1H3 |
| InChIKey | CBBHXOBVIVVYGT-UHFFFAOYSA-N |
| Density | 1.108g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.567°C at 760 mmHg (Cal.) |
| Flash point | 176.522°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Azobenzene-2-Carboxylic Acid Ethyl Ester |